About [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate
[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate (PubChem CID 5049855) has the molecular formula C18H16BrNO4
and a molecular weight of 390.23 g/mol. Its IUPAC name is [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate.
Molecular Properties
| Compound Name | [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate |
| PubChem CID | 5049855 |
| Molecular Formula | C18H16BrNO4 |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate |
| SMILES | COc1ccccc1C1=NOC(COC(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C18H16BrNO4/c1-22-17-5-3-2-4-15(17)16-10-14(24-20-16)11-23-18(21)12-6-8-13(19)9-7-12/h2-9,14H,10-11H2,1H3 |
| InChIKey | JJEZDPCOPZNUOC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate?
The IUPAC name of [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate (CID 5049855) is [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate.
What is the SMILES notation for [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate?
The canonical SMILES for [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate is COc1ccccc1C1=NOC(COC(=O)c2ccc(Br)cc2)C1.
What is the InChIKey of [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate?
The InChIKey is JJEZDPCOPZNUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrNO4/c1-22-17-5-3-2-4-15(17)16-10-14(24-20-16)11-23-18(21)12-6-8-13(19)9-7-12/h2-9,14H,10-11H2,1H3.
What are the key properties of [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate?
[3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate has a molecular weight of 390.23 g/mol, XLogP of 3.81, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl 4-bromobenzoate is sourced from PubChem (CID 5049855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).