C15H13N5O4 — CID 5050034
1-(2,4-dinitrophenyl)-3,4,6-trimethylpyrazolo[5,4-b]pyridine (PubChem CID 5050034) has the molecular formula C15H13N5O4 and a molecular weight of 327.30 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-3,4,6-trimethylpyrazolo[5,4-b]pyridine.
| Compound Name | 1-(2,4-dinitrophenyl)-3,4,6-trimethylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 5050034 |
| Molecular Formula | C15H13N5O4 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-3,4,6-trimethylpyrazolo[5,4-b]pyridine |
| SMILES | Cc1cc(C)c2c(C)nn(-c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C15H13N5O4/c1-8-6-9(2)16-15-14(8)10(3)17-18(15)12-5-4-11(19(21)22)7-13(12)20(23)24/h4-7H,1-3H3 |
| InChIKey | MZFBDARXFMKULB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|