C11H10F5NO4 — CID 5050206
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 5050206) has the molecular formula C11H10F5NO4 and a molecular weight of 315.19 g/mol. Its IUPAC name is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 5050206 |
| Molecular Formula | C11H10F5NO4 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NC(CO)(CO)CO)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F5NO4/c12-5-4(6(13)8(15)9(16)7(5)14)10(21)17-11(1-18,2-19)3-20/h18-20H,1-3H2,(H,17,21) |
| InChIKey | XPQDVDZVDOJIHT-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|