C28H28N4O4S — CID 505036
N-[3-(dimethylsulfamoyl)phenyl]-3-(5-ethylpyrimidin-2-yl)-N-(naphthalen-2-ylmethyl)-3-oxopropanamide (PubChem CID 505036) has the molecular formula C28H28N4O4S and a molecular weight of 516.62 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-3-(5-ethylpyrimidin-2-yl)-N-(naphthalen-2-ylmethyl)-3-oxopropanamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-3-(5-ethylpyrimidin-2-yl)-N-(naphthalen-2-ylmethyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 505036 |
| Molecular Formula | C28H28N4O4S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-3-(5-ethylpyrimidin-2-yl)-N-(naphthalen-2-ylmethyl)-3-oxopropanamide |
| SMILES | CCc1cnc(C(=O)CC(=O)N(Cc2ccc3ccccc3c2)c2cccc(S(=O)(=O)N(C)C)c2)nc1 |
| InChI | InChI=1S/C28H28N4O4S/c1-4-20-17-29-28(30-18-20)26(33)16-27(34)32(19-21-12-13-22-8-5-6-9-23(22)14-21)24-10-7-11-25(15-24)37(35,36)31(2)3/h5-15,17-18H,4,16,19H2,1-3H3 |
| InChIKey | PPMGIFVMHMCJLM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|