About 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole
3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole (PubChem CID 5050701) has the molecular formula C17H14BrN5
and a molecular weight of 368.24 g/mol. Its IUPAC name is 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole.
Molecular Properties
| Compound Name | 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole |
| PubChem CID | 5050701 |
| Molecular Formula | C17H14BrN5 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole |
| SMILES | Cc1cc(C)c2[nH]cc(-c3nnnn3-c3ccc(Br)cc3)c2c1 |
| InChI | InChI=1S/C17H14BrN5/c1-10-7-11(2)16-14(8-10)15(9-19-16)17-20-21-22-23(17)13-5-3-12(18)4-6-13/h3-9,19H,1-2H3 |
| InChIKey | BMVDLCKKAKPHGX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole?
The IUPAC name of 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole (CID 5050701) is 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole.
What is the SMILES notation for 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole?
The canonical SMILES for 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole is Cc1cc(C)c2[nH]cc(-c3nnnn3-c3ccc(Br)cc3)c2c1.
What is the InChIKey of 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole?
The InChIKey is BMVDLCKKAKPHGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrN5/c1-10-7-11(2)16-14(8-10)15(9-19-16)17-20-21-22-23(17)13-5-3-12(18)4-6-13/h3-9,19H,1-2H3.
What are the key properties of 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole?
3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole has a molecular weight of 368.24 g/mol, XLogP of 4.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4-bromophenyl)tetrazol-5-yl]-5,7-dimethyl-1H-indole is sourced from PubChem (CID 5050701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).