C28H27N5O4 — CID 505111
3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-[3-(morpholine-4-carbonyl)phenyl]-N-(naphthalen-2-ylmethyl)-3-oxopropanamide (PubChem CID 505111) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is 3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-[3-(morpholine-4-carbonyl)phenyl]-N-(naphthalen-2-ylmethyl)-3-oxopropanamide.
| Compound Name | 3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-[3-(morpholine-4-carbonyl)phenyl]-N-(naphthalen-2-ylmethyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 505111 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-[3-(morpholine-4-carbonyl)phenyl]-N-(naphthalen-2-ylmethyl)-3-oxopropanamide |
| SMILES | Cc1nc(C(=O)CC(=O)N(Cc2ccc3ccccc3c2)c2cccc(C(=O)N3CCOCC3)c2)n[nH]1 |
| InChI | InChI=1S/C28H27N5O4/c1-19-29-27(31-30-19)25(34)17-26(35)33(18-20-9-10-21-5-2-3-6-22(21)15-20)24-8-4-7-23(16-24)28(36)32-11-13-37-14-12-32/h2-10,15-16H,11-14,17-18H2,1H3,(H,29,30,31) |
| InChIKey | FLPYNEIGZGAAFD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|