C28H26N4O4 — CID 505119
3-[[3-(4-methoxypyrimidin-2-yl)-3-oxopropanoyl]-(naphthalen-2-ylmethyl)amino]-N,N-dimethylbenzamide (PubChem CID 505119) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is 3-[[3-(4-methoxypyrimidin-2-yl)-3-oxopropanoyl]-(naphthalen-2-ylmethyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[[3-(4-methoxypyrimidin-2-yl)-3-oxopropanoyl]-(naphthalen-2-ylmethyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 505119 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 3-[[3-(4-methoxypyrimidin-2-yl)-3-oxopropanoyl]-(naphthalen-2-ylmethyl)amino]-N,N-dimethylbenzamide |
| SMILES | COc1ccnc(C(=O)CC(=O)N(Cc2ccc3ccccc3c2)c2cccc(C(=O)N(C)C)c2)n1 |
| InChI | InChI=1S/C28H26N4O4/c1-31(2)28(35)22-9-6-10-23(16-22)32(18-19-11-12-20-7-4-5-8-21(20)15-19)26(34)17-24(33)27-29-14-13-25(30-27)36-3/h4-16H,17-18H2,1-3H3 |
| InChIKey | FNNVSRSTNNLXRH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|