C13H14F4N2 — CID 5051234
N-(cyclohexylmethylideneamino)-2,3,5,6-tetrafluoroaniline (PubChem CID 5051234) has the molecular formula C13H14F4N2 and a molecular weight of 274.26 g/mol. Its IUPAC name is N-(cyclohexylmethylideneamino)-2,3,5,6-tetrafluoroaniline.
| Compound Name | N-(cyclohexylmethylideneamino)-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 5051234 |
| Molecular Formula | C13H14F4N2 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-(cyclohexylmethylideneamino)-2,3,5,6-tetrafluoroaniline |
| SMILES | Fc1cc(F)c(F)c(NN=CC2CCCCC2)c1F |
| InChI | InChI=1S/C13H14F4N2/c14-9-6-10(15)12(17)13(11(9)16)19-18-7-8-4-2-1-3-5-8/h6-8,19H,1-5H2 |
| InChIKey | IHYCPHKWYVQSGI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|