C38H30N2O4P2 — CID 5051260
1-N,3-N-bis(4-oxo-2,6-diphenyl-1,4λ5-oxaphosphinin-4-yl)benzene-1,3-diamine (PubChem CID 5051260) has the molecular formula C38H30N2O4P2 and a molecular weight of 640.62 g/mol. Its IUPAC name is 1-N,3-N-bis(4-oxo-2,6-diphenyl-1,4λ5-oxaphosphinin-4-yl)benzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis(4-oxo-2,6-diphenyl-1,4λ5-oxaphosphinin-4-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 5051260 |
| Molecular Formula | C38H30N2O4P2 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | 1-N,3-N-bis(4-oxo-2,6-diphenyl-1,4λ5-oxaphosphinin-4-yl)benzene-1,3-diamine |
| SMILES | O=P1(Nc2cccc(NP3(=O)C=C(c4ccccc4)OC(c4ccccc4)=C3)c2)C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C38H30N2O4P2/c41-45(25-35(29-14-5-1-6-15-29)43-36(26-45)30-16-7-2-8-17-30)39-33-22-13-23-34(24-33)40-46(42)27-37(31-18-9-3-10-19-31)44-38(28-46)32-20-11-4-12-21-32/h1-28H,(H,39,41)(H,40,42) |
| InChIKey | UWSODFQIUKRAKN-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|