C21H21F4NO4S — CID 5051542
propan-2-yl 2-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5051542) has the molecular formula C21H21F4NO4S and a molecular weight of 459.46 g/mol. Its IUPAC name is propan-2-yl 2-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5051542 |
| Molecular Formula | C21H21F4NO4S |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | propan-2-yl 2-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(NC(=O)c2cccc(OC(F)(F)C(F)F)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H21F4NO4S/c1-11(2)29-19(28)16-14-8-3-4-9-15(14)31-18(16)26-17(27)12-6-5-7-13(10-12)30-21(24,25)20(22)23/h5-7,10-11,20H,3-4,8-9H2,1-2H3,(H,26,27) |
| InChIKey | KRDCSIRZWALTCY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|