C21H19Cl2N5O3 — CID 505173
3-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]-N-methylbenzamide (PubChem CID 505173) has the molecular formula C21H19Cl2N5O3 and a molecular weight of 460.32 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]-N-methylbenzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 505173 |
| Molecular Formula | C21H19Cl2N5O3 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(N(Cc2ccc(Cl)c(Cl)c2)C(=O)CC(=O)c2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C21H19Cl2N5O3/c1-12-25-20(27-26-12)18(29)10-19(30)28(11-13-6-7-16(22)17(23)8-13)15-5-3-4-14(9-15)21(31)24-2/h3-9H,10-11H2,1-2H3,(H,24,31)(H,25,26,27) |
| InChIKey | JYCVPORJKIILLQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|