About [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol
[8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol (PubChem CID 5051864) has the molecular formula C22H26O4
and a molecular weight of 354.45 g/mol. Its IUPAC name is [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol.
Molecular Properties
| Compound Name | [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol |
| PubChem CID | 5051864 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol |
| SMILES | OCC1(CO)C(c2ccccc2)CC2(CC1c1ccccc1)OCCO2 |
| InChI | InChI=1S/C22H26O4/c23-15-21(16-24)19(17-7-3-1-4-8-17)13-22(25-11-12-26-22)14-20(21)18-9-5-2-6-10-18/h1-10,19-20,23-24H,11-16H2 |
| InChIKey | UAIJEHKRDFNUHF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol?
The IUPAC name of [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol (CID 5051864) is [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol.
What is the SMILES notation for [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol?
The canonical SMILES for [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol is OCC1(CO)C(c2ccccc2)CC2(CC1c1ccccc1)OCCO2.
What is the InChIKey of [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol?
The InChIKey is UAIJEHKRDFNUHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O4/c23-15-21(16-24)19(17-7-3-1-4-8-17)13-22(25-11-12-26-22)14-20(21)18-9-5-2-6-10-18/h1-10,19-20,23-24H,11-16H2.
What are the key properties of [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol?
[8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol has a molecular weight of 354.45 g/mol, XLogP of 3.06, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(hydroxymethyl)-7,9-diphenyl-1,4-dioxaspiro[4.5]decan-8-yl]methanol is sourced from PubChem (CID 5051864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).