About 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine
5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine (PubChem CID 5051963) has the molecular formula C21H11F6N5
and a molecular weight of 447.34 g/mol. Its IUPAC name is 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine.
Molecular Properties
| Compound Name | 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine |
| PubChem CID | 5051963 |
| Molecular Formula | C21H11F6N5 |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine |
| SMILES | FC(F)(F)c1ccc(-c2ncc(-c3ccncc3)c(-c3ccc(C(F)(F)F)nc3)n2)cn1 |
| InChI | InChI=1S/C21H11F6N5/c22-20(23,24)16-3-1-13(9-29-16)18-15(12-5-7-28-8-6-12)11-31-19(32-18)14-2-4-17(30-10-14)21(25,26)27/h1-11H |
| InChIKey | UIRVGQALYMOINH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine?
The IUPAC name of 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine (CID 5051963) is 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine.
What is the SMILES notation for 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine?
The canonical SMILES for 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine is FC(F)(F)c1ccc(-c2ncc(-c3ccncc3)c(-c3ccc(C(F)(F)F)nc3)n2)cn1.
What is the InChIKey of 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine?
The InChIKey is UIRVGQALYMOINH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H11F6N5/c22-20(23,24)16-3-1-13(9-29-16)18-15(12-5-7-28-8-6-12)11-31-19(32-18)14-2-4-17(30-10-14)21(25,26)27/h1-11H.
What are the key properties of 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine?
5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine has a molecular weight of 447.34 g/mol, XLogP of 5.70, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-4-yl-2,4-bis[6-(trifluoromethyl)-3-pyridinyl]pyrimidine is sourced from PubChem (CID 5051963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).