C34H32N2S6 — CID 5051992
4,4,7-trimethyl-5-[[4-[(4,4,7-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methyl]phenyl]methyl]dithiolo[3,4-c]quinoline-1-thione (PubChem CID 5051992) has the molecular formula C34H32N2S6 and a molecular weight of 661.05 g/mol. Its IUPAC name is 4,4,7-trimethyl-5-[[4-[(4,4,7-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methyl]phenyl]methyl]dithiolo[3,4-c]quinoline-1-thione.
| Compound Name | 4,4,7-trimethyl-5-[[4-[(4,4,7-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methyl]phenyl]methyl]dithiolo[3,4-c]quinoline-1-thione |
|---|---|
| PubChem CID | 5051992 |
| Molecular Formula | C34H32N2S6 |
| Molecular Weight | 661.05 g/mol |
| Exact Mass | 660.09 |
| IUPAC Name | 4,4,7-trimethyl-5-[[4-[(4,4,7-trimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methyl]phenyl]methyl]dithiolo[3,4-c]quinoline-1-thione |
| SMILES | Cc1ccc2c(c1)N(Cc1ccc(CN3c4cc(C)ccc4-c4c(ssc4=S)C3(C)C)cc1)C(C)(C)c1ssc(=S)c1-2 |
| InChI | InChI=1S/C34H32N2S6/c1-19-7-13-23-25(15-19)35(33(3,4)29-27(23)31(37)41-39-29)17-21-9-11-22(12-10-21)18-36-26-16-20(2)8-14-24(26)28-30(34(36,5)6)40-42-32(28)38/h7-16H,17-18H2,1-6H3 |
| InChIKey | FKAUWQOBKSWHBL-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.05 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|