C28H25FN4O4 — CID 5052530
4-[[12-[4-(2-fluorophenyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoic acid (PubChem CID 5052530) has the molecular formula C28H25FN4O4 and a molecular weight of 500.53 g/mol. Its IUPAC name is 4-[[12-[4-(2-fluorophenyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoic acid.
| Compound Name | 4-[[12-[4-(2-fluorophenyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 5052530 |
| Molecular Formula | C28H25FN4O4 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 4-[[12-[4-(2-fluorophenyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1cc(N2CCN(c3ccccc3F)CC2)c2noc3c2c1C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C28H25FN4O4/c29-19-8-3-4-9-21(19)32-12-14-33(15-13-32)22-16-20(30-11-5-10-23(34)35)24-25-26(22)31-37-28(25)18-7-2-1-6-17(18)27(24)36/h1-4,6-9,16,30H,5,10-15H2,(H,34,35) |
| InChIKey | NPTXAVKUCWZHKA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|