C27H24N4O6 — CID 5052536
4-[[12-[4-(furan-2-carbonyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoic acid (PubChem CID 5052536) has the molecular formula C27H24N4O6 and a molecular weight of 500.51 g/mol. Its IUPAC name is 4-[[12-[4-(furan-2-carbonyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoic acid.
| Compound Name | 4-[[12-[4-(furan-2-carbonyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 5052536 |
| Molecular Formula | C27H24N4O6 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 4-[[12-[4-(furan-2-carbonyl)piperazin-1-yl]-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1cc(N2CCN(C(=O)c3ccco3)CC2)c2noc3c2c1C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C27H24N4O6/c32-21(33)8-3-9-28-18-15-19(30-10-12-31(13-11-30)27(35)20-7-4-14-36-20)24-23-22(18)25(34)16-5-1-2-6-17(16)26(23)37-29-24/h1-2,4-7,14-15,28H,3,8-13H2,(H,32,33) |
| InChIKey | NNRNOBWREPANOV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|