C23H27N2O3+ — CID 5052548
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(2,5-dimethylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol (PubChem CID 5052548) has the molecular formula C23H27N2O3+ and a molecular weight of 379.48 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(2,5-dimethylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(2,5-dimethylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
|---|---|
| PubChem CID | 5052548 |
| Molecular Formula | C23H27N2O3+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(2,5-dimethylphenyl)-5,6,7,8-tetrahydro-2H-imidazo[1,2-a]pyridin-4-ium-3-ol |
| SMILES | Cc1ccc(C)c(N2CC(O)(c3ccc4c(c3)OCCO4)[N+]3=C2CCCC3)c1 |
| InChI | InChI=1S/C23H27N2O3/c1-16-6-7-17(2)19(13-16)24-15-23(26,25-10-4-3-5-22(24)25)18-8-9-20-21(14-18)28-12-11-27-20/h6-9,13-14,26H,3-5,10-12,15H2,1-2H3/q+1 |
| InChIKey | SDPARQPRPPKYTD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|