C22H21Cl2N5O3 — CID 505262
4-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]-N,N-dimethylbenzamide (PubChem CID 505262) has the molecular formula C22H21Cl2N5O3 and a molecular weight of 474.35 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 505262 |
| Molecular Formula | C22H21Cl2N5O3 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]-N,N-dimethylbenzamide |
| SMILES | Cc1nc(C(=O)CC(=O)N(Cc2ccc(Cl)c(Cl)c2)c2ccc(C(=O)N(C)C)cc2)n[nH]1 |
| InChI | InChI=1S/C22H21Cl2N5O3/c1-13-25-21(27-26-13)19(30)11-20(31)29(12-14-4-9-17(23)18(24)10-14)16-7-5-15(6-8-16)22(32)28(2)3/h4-10H,11-12H2,1-3H3,(H,25,26,27) |
| InChIKey | PHPYXPCZGQVKBS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|