About 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide
2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide (PubChem CID 5052726) has the molecular formula C30H24N2O4
and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide |
| PubChem CID | 5052726 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccc(Oc4ccccc4)cc3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C30H24N2O4/c1-34-28-17-12-20(18-29(28)35-2)27-19-25(24-10-6-7-11-26(24)32-27)30(33)31-21-13-15-23(16-14-21)36-22-8-4-3-5-9-22/h3-19H,1-2H3,(H,31,33) |
| InChIKey | RXFSLPKCMMSKQZ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide (CID 5052726) is 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide is COc1ccc(-c2cc(C(=O)Nc3ccc(Oc4ccccc4)cc3)c3ccccc3n2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide?
The InChIKey is RXFSLPKCMMSKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24N2O4/c1-34-28-17-12-20(18-29(28)35-2)27-19-25(24-10-6-7-11-26(24)32-27)30(33)31-21-13-15-23(16-14-21)36-22-8-4-3-5-9-22/h3-19H,1-2H3,(H,31,33).
What are the key properties of 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide?
2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide has a molecular weight of 476.53 g/mol, XLogP of 6.96, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-N-(4-phenoxyphenyl)quinoline-4-carboxamide is sourced from PubChem (CID 5052726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).