C10H16 — CID 5052860
1,2,4,5-tetramethylcyclohexa-1,4-diene (PubChem CID 5052860) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 1,2,4,5-tetramethylcyclohexa-1,4-diene.
| Compound Name | 1,2,4,5-tetramethylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 5052860 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1,2,4,5-tetramethylcyclohexa-1,4-diene |
| SMILES | CC1=C(C)CC(C)=C(C)C1 |
| InChI | InChI=1S/C10H16/c1-7-5-9(3)10(4)6-8(7)2/h5-6H2,1-4H3 |
| InChIKey | GACALPFXAWHEBC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|