C17H18BrNS2 — CID 5052964
3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 5052964) has the molecular formula C17H18BrNS2 and a molecular weight of 380.38 g/mol. Its IUPAC name is 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 5052964 |
| Molecular Formula | C17H18BrNS2 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC=C1c2ccccc2CSc2sc(Br)cc21 |
| InChI | InChI=1S/C17H18BrNS2/c1-19(2)9-5-8-14-13-7-4-3-6-12(13)11-20-17-15(14)10-16(18)21-17/h3-4,6-8,10H,5,9,11H2,1-2H3 |
| InChIKey | MAKQLASNAWMDLT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_C(4)', 'substructure': 'N/A'} |
|---|