About 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine
3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 5052964) has the molecular formula C17H18BrNS2
and a molecular weight of 380.38 g/mol. Its IUPAC name is 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine |
| PubChem CID | 5052964 |
| Molecular Formula | C17H18BrNS2 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC=C1c2ccccc2CSc2sc(Br)cc21 |
| InChI | InChI=1S/C17H18BrNS2/c1-19(2)9-5-8-14-13-7-4-3-6-12(13)11-20-17-15(14)10-16(18)21-17/h3-4,6-8,10H,5,9,11H2,1-2H3 |
| InChIKey | MAKQLASNAWMDLT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'styrene_C(4)', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine (CID 5052964) is 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine is CN(C)CCC=C1c2ccccc2CSc2sc(Br)cc21.
What is the InChIKey of 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine?
The InChIKey is MAKQLASNAWMDLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrNS2/c1-19(2)9-5-8-14-13-7-4-3-6-12(13)11-20-17-15(14)10-16(18)21-17/h3-4,6-8,10H,5,9,11H2,1-2H3.
What are the key properties of 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine?
3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine has a molecular weight of 380.38 g/mol, XLogP of 5.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-5H-thieno[2,3-c][2]benzothiepin-10-ylidene)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 5052964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).