C20H16Cl3N5O3 — CID 505317
2-chloro-4-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]benzamide (PubChem CID 505317) has the molecular formula C20H16Cl3N5O3 and a molecular weight of 480.74 g/mol. Its IUPAC name is 2-chloro-4-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]benzamide.
| Compound Name | 2-chloro-4-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]benzamide |
|---|---|
| PubChem CID | 505317 |
| Molecular Formula | C20H16Cl3N5O3 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 2-chloro-4-[(3,4-dichlorophenyl)methyl-[3-(5-methyl-1H-1,2,4-triazol-3-yl)-3-oxopropanoyl]amino]benzamide |
| SMILES | Cc1nc(C(=O)CC(=O)N(Cc2ccc(Cl)c(Cl)c2)c2ccc(C(N)=O)c(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C20H16Cl3N5O3/c1-10-25-20(27-26-10)17(29)8-18(30)28(9-11-2-5-14(21)16(23)6-11)12-3-4-13(19(24)31)15(22)7-12/h2-7H,8-9H2,1H3,(H2,24,31)(H,25,26,27) |
| InChIKey | ZGDDECOTDNDGBA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|