C19H22N2O3S2 — CID 5053215
2-(1,1-dioxothiolan-3-yl)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 5053215) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 5053215 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)Nc1nc(-c2ccc3c(c2)CCCC3)cs1 |
| InChI | InChI=1S/C19H22N2O3S2/c22-18(9-13-7-8-26(23,24)12-13)21-19-20-17(11-25-19)16-6-5-14-3-1-2-4-15(14)10-16/h5-6,10-11,13H,1-4,7-9,12H2,(H,20,21,22) |
| InChIKey | NKFZBRHCTCYFAH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |