C14H13N3O3S — CID 5053752
4-(2,4-dimethoxyphenyl)-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 5053752) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,4-dimethoxyphenyl)-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 5053752 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-n2c(-c3ccco3)n[nH]c2=S)c(OC)c1 |
| InChI | InChI=1S/C14H13N3O3S/c1-18-9-5-6-10(12(8-9)19-2)17-13(15-16-14(17)21)11-4-3-7-20-11/h3-8H,1-2H3,(H,16,21) |
| InChIKey | FEOQHXJXHIOMSN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|