C16H23N5O4 — CID 5053814
2-[[7-(3,5-dimethylpiperidin-1-yl)-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol (PubChem CID 5053814) has the molecular formula C16H23N5O4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[[7-(3,5-dimethylpiperidin-1-yl)-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol.
| Compound Name | 2-[[7-(3,5-dimethylpiperidin-1-yl)-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 5053814 |
| Molecular Formula | C16H23N5O4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[[7-(3,5-dimethylpiperidin-1-yl)-4-nitro-2,1,3-benzoxadiazol-5-yl]-methylamino]ethanol |
| SMILES | CC1CC(C)CN(c2cc(N(C)CCO)c([N+](=O)[O-])c3nonc23)C1 |
| InChI | InChI=1S/C16H23N5O4/c1-10-6-11(2)9-20(8-10)12-7-13(19(3)4-5-22)16(21(23)24)15-14(12)17-25-18-15/h7,10-11,22H,4-6,8-9H2,1-3H3 |
| InChIKey | ZIJWJVHJPPZHKS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|