About N-prop-2-enylpropanamide
N-prop-2-enylpropanamide (PubChem CID 5053902) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is N-prop-2-enylpropanamide.
Molecular Properties
| Compound Name | N-prop-2-enylpropanamide |
| PubChem CID | 5053902 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)CC |
| InChI | InChI=1S/C6H11NO/c1-3-5-7-6(8)4-2/h3H,1,4-5H2,2H3,(H,7,8) |
| InChIKey | JVVWOKSULSIVFP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enylpropanamide?
The IUPAC name of N-prop-2-enylpropanamide (CID 5053902) is N-prop-2-enylpropanamide.
What is the SMILES notation for N-prop-2-enylpropanamide?
The canonical SMILES for N-prop-2-enylpropanamide is C=CCNC(=O)CC.
What is the InChIKey of N-prop-2-enylpropanamide?
The InChIKey is JVVWOKSULSIVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-3-5-7-6(8)4-2/h3H,1,4-5H2,2H3,(H,7,8).
What are the key properties of N-prop-2-enylpropanamide?
N-prop-2-enylpropanamide has a molecular weight of 113.16 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enylpropanamide is sourced from PubChem (CID 5053902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).