C21H25N2O2S+ — CID 5054134
1-benzyl-2-(4-ethoxyphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol (PubChem CID 5054134) has the molecular formula C21H25N2O2S+ and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-benzyl-2-(4-ethoxyphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol.
| Compound Name | 1-benzyl-2-(4-ethoxyphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
|---|---|
| PubChem CID | 5054134 |
| Molecular Formula | C21H25N2O2S+ |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-benzyl-2-(4-ethoxyphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
| SMILES | CCOc1ccc(C2(O)C[N+]3=C(SCCC3)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25N2O2S/c1-2-25-19-11-9-18(10-12-19)21(24)16-22-13-6-14-26-20(22)23(21)15-17-7-4-3-5-8-17/h3-5,7-12,24H,2,6,13-16H2,1H3/q+1 |
| InChIKey | COUWGFIAMAUTJC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|