C33H49NO4 — CID 5054368
cyclohexyl-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 5054368) has the molecular formula C33H49NO4 and a molecular weight of 523.76 g/mol. Its IUPAC name is cyclohexyl-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 5054368 |
| Molecular Formula | C33H49NO4 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | cyclohexyl-[5,13-dihydroxy-6,10-dimethyl-5-(morpholin-4-ylmethyl)-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCOCC1 |
| InChI | InChI=1S/C33H49NO4/c1-29-11-8-24(35)20-31(29)14-15-33(25(21-31)28(36)23-6-4-3-5-7-23)26(29)9-12-30(2)27(33)10-13-32(30,37)22-34-16-18-38-19-17-34/h14-15,21,23-24,26-27,35,37H,3-13,16-20,22H2,1-2H3 |
| InChIKey | APYHJPCBJMTOGZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|