C9H9F3N2O3S — CID 5054923
2,2,2-trifluoro-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 5054923) has the molecular formula C9H9F3N2O3S and a molecular weight of 282.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 5054923 |
| Molecular Formula | C9H9F3N2O3S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2,2,2-trifluoro-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9F3N2O3S/c10-9(11,12)8(15)14-5-6-1-3-7(4-2-6)18(13,16)17/h1-4H,5H2,(H,14,15)(H2,13,16,17) |
| InChIKey | PSURAFILOCZAMG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |