C16H8F4N6O2 — CID 505535
4-[[4-amino-6-(2,3,5,6-tetrafluoro-4-hydroxyphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 505535) has the molecular formula C16H8F4N6O2 and a molecular weight of 392.27 g/mol. Its IUPAC name is 4-[[4-amino-6-(2,3,5,6-tetrafluoro-4-hydroxyphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-amino-6-(2,3,5,6-tetrafluoro-4-hydroxyphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 505535 |
| Molecular Formula | C16H8F4N6O2 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4-[[4-amino-6-(2,3,5,6-tetrafluoro-4-hydroxyphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc(N)nc(Oc3c(F)c(F)c(O)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C16H8F4N6O2/c17-8-10(19)13(11(20)9(18)12(8)27)28-16-25-14(22)24-15(26-16)23-7-3-1-6(5-21)2-4-7/h1-4,27H,(H3,22,23,24,25,26) |
| InChIKey | IUPZKFLFKIXCHR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|