C28H30N2O5 — CID 505542
tert-butyl 4-[3-(dimethylcarbamoyl)-N-(naphthalen-2-ylmethyl)anilino]-2,4-dioxobutanoate (PubChem CID 505542) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is tert-butyl 4-[3-(dimethylcarbamoyl)-N-(naphthalen-2-ylmethyl)anilino]-2,4-dioxobutanoate.
| Compound Name | tert-butyl 4-[3-(dimethylcarbamoyl)-N-(naphthalen-2-ylmethyl)anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505542 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | tert-butyl 4-[3-(dimethylcarbamoyl)-N-(naphthalen-2-ylmethyl)anilino]-2,4-dioxobutanoate |
| SMILES | CN(C)C(=O)c1cccc(N(Cc2ccc3ccccc3c2)C(=O)CC(=O)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C28H30N2O5/c1-28(2,3)35-27(34)24(31)17-25(32)30(23-12-8-11-22(16-23)26(33)29(4)5)18-19-13-14-20-9-6-7-10-21(20)15-19/h6-16H,17-18H2,1-5H3 |
| InChIKey | KLYRLUQMTNCGPR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|