C26H28Cl2N2O5 — CID 505543
(1-methylcyclopentyl) 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate (PubChem CID 505543) has the molecular formula C26H28Cl2N2O5 and a molecular weight of 519.43 g/mol. Its IUPAC name is (1-methylcyclopentyl) 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate.
| Compound Name | (1-methylcyclopentyl) 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505543 |
| Molecular Formula | C26H28Cl2N2O5 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | (1-methylcyclopentyl) 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
| SMILES | CN(C)C(=O)c1ccc(N(Cc2ccc(Cl)c(Cl)c2)C(=O)CC(=O)C(=O)OC2(C)CCCC2)cc1 |
| InChI | InChI=1S/C26H28Cl2N2O5/c1-26(12-4-5-13-26)35-25(34)22(31)15-23(32)30(16-17-6-11-20(27)21(28)14-17)19-9-7-18(8-10-19)24(33)29(2)3/h6-11,14H,4-5,12-13,15-16H2,1-3H3 |
| InChIKey | ZFINGFZYRUQNGW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|