About tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate
tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate (PubChem CID 505561) has the molecular formula C25H22BrCl2NO4
and a molecular weight of 551.26 g/mol. Its IUPAC name is tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate.
Molecular Properties
| Compound Name | tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate |
| PubChem CID | 505561 |
| Molecular Formula | C25H22BrCl2NO4 |
| Molecular Weight | 551.26 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate |
| SMILES | CC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1Br)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H22BrCl2NO4/c1-25(2,3)33-24(32)21(30)13-22(31)29(17-10-11-19(27)20(28)12-17)14-16-9-8-15-6-4-5-7-18(15)23(16)26/h4-12H,13-14H2,1-3H3 |
| InChIKey | ZUNBQHUHACLAME-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.26 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate?
The IUPAC name of tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate (CID 505561) is tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate.
What is the SMILES notation for tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate?
The canonical SMILES for tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate is CC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccc2ccccc2c1Br)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate?
The InChIKey is ZUNBQHUHACLAME-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22BrCl2NO4/c1-25(2,3)33-24(32)21(30)13-22(31)29(17-10-11-19(27)20(28)12-17)14-16-9-8-15-6-4-5-7-18(15)23(16)26/h4-12H,13-14H2,1-3H3.
What are the key properties of tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate?
tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate has a molecular weight of 551.26 g/mol, XLogP of 6.74, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[N-[(1-bromonaphthalen-2-yl)methyl]-3,4-dichloroanilino]-2,4-dioxobutanoate is sourced from PubChem (CID 505561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).