methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate

C22H14F2N2O2 — CID 5055731

IUPACmethyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate
SMILESCOC(=O)c1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1
InChIInChI=1S/C22H14F2N2O2/c1-28-22(27)15-6-11-18-19(12-15)26-21(14-4-9-17(24)10-5-14)20(25-18)13-2-7-16(23)8-3-13/h2-12H,1H3
InChIKeyHGCJINRLCSLVHH-UHFFFAOYSA-N
MW376.36 g/mol
LogP5.03
Rot. Bonds3

About methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate

methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate (PubChem CID 5055731) has the molecular formula C22H14F2N2O2 and a molecular weight of 376.36 g/mol. Its IUPAC name is methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate.

Molecular Properties

Compound Namemethyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate
PubChem CID5055731
Molecular FormulaC22H14F2N2O2
Molecular Weight376.36 g/mol
Exact Mass376.10
IUPAC Namemethyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate
SMILESCOC(=O)c1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1
InChIInChI=1S/C22H14F2N2O2/c1-28-22(27)15-6-11-18-19(12-15)26-21(14-4-9-17(24)10-5-14)20(25-18)13-2-7-16(23)8-3-13/h2-12H,1H3
InChIKeyHGCJINRLCSLVHH-UHFFFAOYSA-N
XLogP5.03
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500376.36
LogP ≤ 55.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate?
The IUPAC name of methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate (CID 5055731) is methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate.
What is the SMILES notation for methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate?
The canonical SMILES for methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate is COC(=O)c1ccc2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)nc2c1.
What is the InChIKey of methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate?
The InChIKey is HGCJINRLCSLVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F2N2O2/c1-28-22(27)15-6-11-18-19(12-15)26-21(14-4-9-17(24)10-5-14)20(25-18)13-2-7-16(23)8-3-13/h2-12H,1H3.
What are the key properties of methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate?
methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate has a molecular weight of 376.36 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-bis(4-fluorophenyl)quinoxaline-6-carboxylate is sourced from PubChem (CID 5055731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).