C27H32Cl2N2O7 — CID 505636
[1-(2-methoxyethoxy)-2-methylpropan-2-yl] 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate (PubChem CID 505636) has the molecular formula C27H32Cl2N2O7 and a molecular weight of 567.47 g/mol. Its IUPAC name is [1-(2-methoxyethoxy)-2-methylpropan-2-yl] 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate.
| Compound Name | [1-(2-methoxyethoxy)-2-methylpropan-2-yl] 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505636 |
| Molecular Formula | C27H32Cl2N2O7 |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [1-(2-methoxyethoxy)-2-methylpropan-2-yl] 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
| SMILES | COCCOCC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccc(Cl)c(Cl)c1)c1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C27H32Cl2N2O7/c1-27(2,17-37-13-12-36-5)38-26(35)23(32)15-24(33)31(16-18-6-11-21(28)22(29)14-18)20-9-7-19(8-10-20)25(34)30(3)4/h6-11,14H,12-13,15-17H2,1-5H3 |
| InChIKey | VVCSBVDNAWKFSH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|