C24H23Cl2F3N2O5 — CID 505641
(1,1,1-trifluoro-2-methylpropan-2-yl) 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate (PubChem CID 505641) has the molecular formula C24H23Cl2F3N2O5 and a molecular weight of 547.36 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 505641 |
| Molecular Formula | C24H23Cl2F3N2O5 |
| Molecular Weight | 547.36 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) 4-[N-[(3,4-dichlorophenyl)methyl]-4-(dimethylcarbamoyl)anilino]-2,4-dioxobutanoate |
| SMILES | CN(C)C(=O)c1ccc(N(Cc2ccc(Cl)c(Cl)c2)C(=O)CC(=O)C(=O)OC(C)(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H23Cl2F3N2O5/c1-23(2,24(27,28)29)36-22(35)19(32)12-20(33)31(13-14-5-10-17(25)18(26)11-14)16-8-6-15(7-9-16)21(34)30(3)4/h5-11H,12-13H2,1-4H3 |
| InChIKey | BOKQWHDGFZDWHI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|