C23H23Cl2NO6 — CID 505648
3-[(3,4-dichlorophenyl)methyl-[4-(2-methylbutan-2-yloxy)-3,4-dioxobutanoyl]amino]benzoic acid (PubChem CID 505648) has the molecular formula C23H23Cl2NO6 and a molecular weight of 480.34 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl-[4-(2-methylbutan-2-yloxy)-3,4-dioxobutanoyl]amino]benzoic acid.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl-[4-(2-methylbutan-2-yloxy)-3,4-dioxobutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 505648 |
| Molecular Formula | C23H23Cl2NO6 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl-[4-(2-methylbutan-2-yloxy)-3,4-dioxobutanoyl]amino]benzoic acid |
| SMILES | CCC(C)(C)OC(=O)C(=O)CC(=O)N(Cc1ccc(Cl)c(Cl)c1)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C23H23Cl2NO6/c1-4-23(2,3)32-22(31)19(27)12-20(28)26(13-14-8-9-17(24)18(25)10-14)16-7-5-6-15(11-16)21(29)30/h5-11H,4,12-13H2,1-3H3,(H,29,30) |
| InChIKey | GXEPTDNPJJUNAS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|