About 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide
4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide (PubChem CID 5056530) has the molecular formula C17H22N4O4
and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide.
Molecular Properties
| Compound Name | 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide |
| PubChem CID | 5056530 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide |
| SMILES | COc1ccc(CNC(=O)CCCn2nc(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C17H22N4O4/c1-12-17(21(23)24)13(2)20(19-12)10-4-5-16(22)18-11-14-6-8-15(25-3)9-7-14/h6-9H,4-5,10-11H2,1-3H3,(H,18,22) |
| InChIKey | IICVRLAOFGSAFQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide?
The IUPAC name of 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide (CID 5056530) is 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide.
What is the SMILES notation for 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide?
The canonical SMILES for 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide is COc1ccc(CNC(=O)CCCn2nc(C)c([N+](=O)[O-])c2C)cc1.
What is the InChIKey of 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide?
The InChIKey is IICVRLAOFGSAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O4/c1-12-17(21(23)24)13(2)20(19-12)10-4-5-16(22)18-11-14-6-8-15(25-3)9-7-14/h6-9H,4-5,10-11H2,1-3H3,(H,18,22).
What are the key properties of 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide?
4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide has a molecular weight of 346.39 g/mol, XLogP of 2.51, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(4-methoxyphenyl)methyl]butanamide is sourced from PubChem (CID 5056530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).