C22H14Cl4O3 — CID 5056573
2,3,4a,8a-tetrachloro-6-ethenyl-5-(4-hydroxynaphthalen-1-yl)-5,8-dihydronaphthalene-1,4-dione (PubChem CID 5056573) has the molecular formula C22H14Cl4O3 and a molecular weight of 468.16 g/mol. Its IUPAC name is 2,3,4a,8a-tetrachloro-6-ethenyl-5-(4-hydroxynaphthalen-1-yl)-5,8-dihydronaphthalene-1,4-dione.
| Compound Name | 2,3,4a,8a-tetrachloro-6-ethenyl-5-(4-hydroxynaphthalen-1-yl)-5,8-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 5056573 |
| Molecular Formula | C22H14Cl4O3 |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 2,3,4a,8a-tetrachloro-6-ethenyl-5-(4-hydroxynaphthalen-1-yl)-5,8-dihydronaphthalene-1,4-dione |
| SMILES | C=CC1=CCC2(Cl)C(=O)C(Cl)=C(Cl)C(=O)C2(Cl)C1c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C22H14Cl4O3/c1-2-11-9-10-21(25)19(28)17(23)18(24)20(29)22(21,26)16(11)14-7-8-15(27)13-6-4-3-5-12(13)14/h2-9,16,27H,1,10H2 |
| InChIKey | JCRBJVCIAFMTKF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|