C20H29N3O3 — CID 5056758
N'-[4-(azepane-1-carbonyl)phenyl]-N-(3-methylbutyl)oxamide (PubChem CID 5056758) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N'-[4-(azepane-1-carbonyl)phenyl]-N-(3-methylbutyl)oxamide.
| Compound Name | N'-[4-(azepane-1-carbonyl)phenyl]-N-(3-methylbutyl)oxamide |
|---|---|
| PubChem CID | 5056758 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N'-[4-(azepane-1-carbonyl)phenyl]-N-(3-methylbutyl)oxamide |
| SMILES | CC(C)CCNC(=O)C(=O)Nc1ccc(C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C20H29N3O3/c1-15(2)11-12-21-18(24)19(25)22-17-9-7-16(8-10-17)20(26)23-13-5-3-4-6-14-23/h7-10,15H,3-6,11-14H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | KXZIDFFMEYITLF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|