About 2-ethyl-N,N-dipropylhexanamide
2-ethyl-N,N-dipropylhexanamide (PubChem CID 5056847) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-ethyl-N,N-dipropylhexanamide.
Molecular Properties
| Compound Name | 2-ethyl-N,N-dipropylhexanamide |
| PubChem CID | 5056847 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-ethyl-N,N-dipropylhexanamide |
| SMILES | CCCCC(CC)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C14H29NO/c1-5-9-10-13(8-4)14(16)15(11-6-2)12-7-3/h13H,5-12H2,1-4H3 |
| InChIKey | YTPZZUAPUOFFID-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-N,N-dipropylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,N-dipropylhexanamide?
The IUPAC name of 2-ethyl-N,N-dipropylhexanamide (CID 5056847) is 2-ethyl-N,N-dipropylhexanamide.
What is the SMILES notation for 2-ethyl-N,N-dipropylhexanamide?
The canonical SMILES for 2-ethyl-N,N-dipropylhexanamide is CCCCC(CC)C(=O)N(CCC)CCC.
What is the InChIKey of 2-ethyl-N,N-dipropylhexanamide?
The InChIKey is YTPZZUAPUOFFID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-5-9-10-13(8-4)14(16)15(11-6-2)12-7-3/h13H,5-12H2,1-4H3.
What are the key properties of 2-ethyl-N,N-dipropylhexanamide?
2-ethyl-N,N-dipropylhexanamide has a molecular weight of 227.39 g/mol, XLogP of 3.85, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,N-dipropylhexanamide is sourced from PubChem (CID 5056847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).