C14H6N4O4 — CID 505777
14-nitro-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione (PubChem CID 505777) has the molecular formula C14H6N4O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is 14-nitro-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione.
| Compound Name | 14-nitro-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione |
|---|---|
| PubChem CID | 505777 |
| Molecular Formula | C14H6N4O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 14-nitro-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-n2c1nc1ncccc1c2=O |
| InChI | InChI=1S/C14H6N4O4/c19-11-9-6-7(18(21)22)3-4-10(9)17-13(11)16-12-8(14(17)20)2-1-5-15-12/h1-6H |
| InChIKey | JFKIDZDKVRLLAB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 107.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|