About 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione
8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione (PubChem CID 505821) has the molecular formula C22H13FN2O3
and a molecular weight of 372.36 g/mol. Its IUPAC name is 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione.
Molecular Properties
| Compound Name | 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione |
| PubChem CID | 505821 |
| Molecular Formula | C22H13FN2O3 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione |
| SMILES | O=C1c2cc(F)ccc2-n2c1nc1c(OCc3ccccc3)cccc1c2=O |
| InChI | InChI=1S/C22H13FN2O3/c23-14-9-10-17-16(11-14)20(26)21-24-19-15(22(27)25(17)21)7-4-8-18(19)28-12-13-5-2-1-3-6-13/h1-11H,12H2 |
| InChIKey | BLZUGSSQHNOJFU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione?
The IUPAC name of 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione (CID 505821) is 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione.
What is the SMILES notation for 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione?
The canonical SMILES for 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione is O=C1c2cc(F)ccc2-n2c1nc1c(OCc3ccccc3)cccc1c2=O.
What is the InChIKey of 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione?
The InChIKey is BLZUGSSQHNOJFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13FN2O3/c23-14-9-10-17-16(11-14)20(26)21-24-19-15(22(27)25(17)21)7-4-8-18(19)28-12-13-5-2-1-3-6-13/h1-11H,12H2.
What are the key properties of 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione?
8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione has a molecular weight of 372.36 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-phenylmethoxyindolo[2,1-b]quinazoline-6,12-dione is sourced from PubChem (CID 505821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).