About 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea
1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea (PubChem CID 5058212) has the molecular formula C19H23ClN2O3S
and a molecular weight of 394.92 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea |
| PubChem CID | 5058212 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCC(C)CSc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H23ClN2O3S/c1-13(12-26-16-7-4-14(20)5-8-16)11-21-19(23)22-17-9-6-15(24-2)10-18(17)25-3/h4-10,13H,11-12H2,1-3H3,(H2,21,22,23) |
| InChIKey | SDZJWAKZRHLNPZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea?
The IUPAC name of 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea (CID 5058212) is 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea.
What is the SMILES notation for 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea?
The canonical SMILES for 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea is COc1ccc(NC(=O)NCC(C)CSc2ccc(Cl)cc2)c(OC)c1.
What is the InChIKey of 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea?
The InChIKey is SDZJWAKZRHLNPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClN2O3S/c1-13(12-26-16-7-4-14(20)5-8-16)11-21-19(23)22-17-9-6-15(24-2)10-18(17)25-3/h4-10,13H,11-12H2,1-3H3,(H2,21,22,23).
What are the key properties of 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea?
1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea has a molecular weight of 394.92 g/mol, XLogP of 4.91, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2,4-dimethoxyphenyl)urea is sourced from PubChem (CID 5058212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).