C25H24ClN2O4+ — CID 5058348
2-[6-(1,3-benzodioxol-5-yl)-2-(2-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]-6-ethoxyphenol (PubChem CID 5058348) has the molecular formula C25H24ClN2O4+ and a molecular weight of 451.93 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-yl)-2-(2-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]-6-ethoxyphenol.
| Compound Name | 2-[6-(1,3-benzodioxol-5-yl)-2-(2-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 5058348 |
| Molecular Formula | C25H24ClN2O4+ |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-yl)-2-(2-chlorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]-6-ethoxyphenol |
| SMILES | CCOc1cccc(C2C=C(c3ccc4c(c3)OCO4)NC(c3ccccc3Cl)[NH2+]2)c1O |
| InChI | InChI=1S/C25H23ClN2O4/c1-2-30-22-9-5-7-17(24(22)29)20-13-19(15-10-11-21-23(12-15)32-14-31-21)27-25(28-20)16-6-3-4-8-18(16)26/h3-13,20,25,27-29H,2,14H2,1H3/p+1 |
| InChIKey | XMEIMLIUEUQKKC-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|