C14H6IN3O2 — CID 505836
14-iodo-2,5,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione (PubChem CID 505836) has the molecular formula C14H6IN3O2 and a molecular weight of 375.13 g/mol. Its IUPAC name is 14-iodo-2,5,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione.
| Compound Name | 14-iodo-2,5,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione |
|---|---|
| PubChem CID | 505836 |
| Molecular Formula | C14H6IN3O2 |
| Molecular Weight | 375.13 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 14-iodo-2,5,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11(16),12,14-heptaene-9,17-dione |
| SMILES | O=C1c2cc(I)ccc2-n2c1nc1cnccc1c2=O |
| InChI | InChI=1S/C14H6IN3O2/c15-7-1-2-11-9(5-7)12(19)13-17-10-6-16-4-3-8(10)14(20)18(11)13/h1-6H |
| InChIKey | ZYUDKXIFGIQSRG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.13 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|