C15H6F3N3O2 — CID 505839
15-(trifluoromethyl)-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaene-9,17-dione (PubChem CID 505839) has the molecular formula C15H6F3N3O2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 15-(trifluoromethyl)-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaene-9,17-dione.
| Compound Name | 15-(trifluoromethyl)-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaene-9,17-dione |
|---|---|
| PubChem CID | 505839 |
| Molecular Formula | C15H6F3N3O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 15-(trifluoromethyl)-2,4,10-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,11,13,15-heptaene-9,17-dione |
| SMILES | O=C1c2c(cccc2C(F)(F)F)-n2c1nc1ncccc1c2=O |
| InChI | InChI=1S/C15H6F3N3O2/c16-15(17,18)8-4-1-5-9-10(8)11(22)13-20-12-7(3-2-6-19-12)14(23)21(9)13/h1-6H |
| InChIKey | MMMQRPLQEAIMGY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |