C27H26N2O4 — CID 5058501
3-(4-hydroxyphenyl)-3a-methyl-2-phenyl-5-(2,4,6-trimethylphenyl)-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 5058501) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3a-methyl-2-phenyl-5-(2,4,6-trimethylphenyl)-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(4-hydroxyphenyl)-3a-methyl-2-phenyl-5-(2,4,6-trimethylphenyl)-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 5058501 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3a-methyl-2-phenyl-5-(2,4,6-trimethylphenyl)-3,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1cc(C)c(N2C(=O)C3ON(c4ccccc4)C(c4ccc(O)cc4)C3(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-16-14-17(2)22(18(3)15-16)28-25(31)24-27(4,26(28)32)23(19-10-12-21(30)13-11-19)29(33-24)20-8-6-5-7-9-20/h5-15,23-24,30H,1-4H3 |
| InChIKey | QMVPIMFSWQKPND-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|