C31H42N4O — CID 505873
cyclohexyl-[(3S,4S)-3-phenyl-4-[[4-[prop-2-enyl(pyridin-3-yl)amino]piperidin-1-yl]methyl]pyrrolidin-1-yl]methanone (PubChem CID 505873) has the molecular formula C31H42N4O and a molecular weight of 486.70 g/mol. Its IUPAC name is cyclohexyl-[(3S,4S)-3-phenyl-4-[[4-[prop-2-enyl(pyridin-3-yl)amino]piperidin-1-yl]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | cyclohexyl-[(3S,4S)-3-phenyl-4-[[4-[prop-2-enyl(pyridin-3-yl)amino]piperidin-1-yl]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 505873 |
| Molecular Formula | C31H42N4O |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | cyclohexyl-[(3S,4S)-3-phenyl-4-[[4-[prop-2-enyl(pyridin-3-yl)amino]piperidin-1-yl]methyl]pyrrolidin-1-yl]methanone |
| SMILES | C=CCN(c1cccnc1)C1CCN(C[C@H]2CN(C(=O)C3CCCCC3)C[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C31H42N4O/c1-2-18-35(29-14-9-17-32-21-29)28-15-19-33(20-16-28)22-27-23-34(31(36)26-12-7-4-8-13-26)24-30(27)25-10-5-3-6-11-25/h2-3,5-6,9-11,14,17,21,26-28,30H,1,4,7-8,12-13,15-16,18-20,22-24H2/t27-,30+/m0/s1 |
| InChIKey | YTDFWQAHEGHFQA-BHBYDHKZSA-N |
| XLogP | 5.36 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|