About methyl 3-carbamimidoylbenzoate
methyl 3-carbamimidoylbenzoate (PubChem CID 5059086) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is methyl 3-carbamimidoylbenzoate.
Molecular Properties
| Compound Name | methyl 3-carbamimidoylbenzoate |
| PubChem CID | 5059086 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | methyl 3-carbamimidoylbenzoate |
| SMILES | [H]/N=C(\N)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C9H10N2O2/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H3,10,11) |
| InChIKey | PRAYXRLPTMXYEZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-carbamimidoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-carbamimidoylbenzoate?
The IUPAC name of methyl 3-carbamimidoylbenzoate (CID 5059086) is methyl 3-carbamimidoylbenzoate.
What is the SMILES notation for methyl 3-carbamimidoylbenzoate?
The canonical SMILES for methyl 3-carbamimidoylbenzoate is [H]/N=C(\N)c1cccc(C(=O)OC)c1.
What is the InChIKey of methyl 3-carbamimidoylbenzoate?
The InChIKey is PRAYXRLPTMXYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H3,10,11).
What are the key properties of methyl 3-carbamimidoylbenzoate?
methyl 3-carbamimidoylbenzoate has a molecular weight of 178.19 g/mol, XLogP of 0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-carbamimidoylbenzoate is sourced from PubChem (CID 5059086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).